C14H21N3O3 — CID 82696757
[2-(aminomethyl)-4-pyridinyl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone (PubChem CID 82696757) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is [2-(aminomethyl)-4-pyridinyl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone.
| Compound Name | [2-(aminomethyl)-4-pyridinyl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 82696757 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [2-(aminomethyl)-4-pyridinyl]-[4-(2-hydroxyethoxy)piperidin-1-yl]methanone |
| SMILES | NCc1cc(C(=O)N2CCC(OCCO)CC2)ccn1 |
| InChI | InChI=1S/C14H21N3O3/c15-10-12-9-11(1-4-16-12)14(19)17-5-2-13(3-6-17)20-8-7-18/h1,4,9,13,18H,2-3,5-8,10,15H2 |
| InChIKey | RSOBQESZRIOZTD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |