C11H16N4O — CID 107500713
2-[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]ethanamine (PubChem CID 107500713) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]ethanamine.
| Compound Name | 2-[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 107500713 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]ethanamine |
| SMILES | NCCn1cnc(CNCc2ccco2)c1 |
| InChI | InChI=1S/C11H16N4O/c12-3-4-15-8-10(14-9-15)6-13-7-11-2-1-5-16-11/h1-2,5,8-9,13H,3-4,6-7,12H2 |
| InChIKey | OEWNLPNZNAWTFQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |