C17H16KN3O3 — CID 68822538
potassium 4-[[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]methyl]benzoate (PubChem CID 68822538) has the molecular formula C17H16KN3O3 and a molecular weight of 349.43 g/mol. Its IUPAC name is potassium 4-[[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | potassium 4-[[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 68822538 |
| Molecular Formula | C17H16KN3O3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | potassium 4-[[4-[(furan-2-ylmethylamino)methyl]imidazol-1-yl]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(Cn2cnc(CNCc3ccco3)c2)cc1.[K+] |
| InChI | InChI=1S/C17H17N3O3.K/c21-17(22)14-5-3-13(4-6-14)10-20-11-15(19-12-20)8-18-9-16-2-1-7-23-16;/h1-7,11-12,18H,8-10H2,(H,21,22);/q;+1/p-1 |
| InChIKey | QMMWVWYHXNQBNC-UHFFFAOYSA-M |
| XLogP | -1.82 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |