C11H13NS — CID 10750247
(4S)-4-benzyl-2-methyl-4,5-dihydro-1,3-thiazole (PubChem CID 10750247) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is (4S)-4-benzyl-2-methyl-4,5-dihydro-1,3-thiazole.
| Compound Name | (4S)-4-benzyl-2-methyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 10750247 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (4S)-4-benzyl-2-methyl-4,5-dihydro-1,3-thiazole |
| SMILES | CC1=N[C@@H](Cc2ccccc2)CS1 |
| InChI | InChI=1S/C11H13NS/c1-9-12-11(8-13-9)7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | LIAYJYKOSOBXQB-NSHDSACASA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |