C10H12N2O2 — CID 10750263
ethyl 5,6-dihydroimidazo[1,5-a]pyridine-7-carboxylate (PubChem CID 10750263) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is ethyl 5,6-dihydroimidazo[1,5-a]pyridine-7-carboxylate.
| Compound Name | ethyl 5,6-dihydroimidazo[1,5-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 10750263 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | ethyl 5,6-dihydroimidazo[1,5-a]pyridine-7-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cncn2CC1 |
| InChI | InChI=1S/C10H12N2O2/c1-2-14-10(13)8-3-4-12-7-11-6-9(12)5-8/h5-7H,2-4H2,1H3 |
| InChIKey | HDNRAYPOKBZVKB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |