C12H20N2 — CID 107503528
1-(2,6-dimethyl-4-pyridinyl)-N-methylbutan-1-amine (PubChem CID 107503528) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)-N-methylbutan-1-amine.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 107503528 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)-N-methylbutan-1-amine |
| SMILES | CCCC(NC)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C12H20N2/c1-5-6-12(13-4)11-7-9(2)14-10(3)8-11/h7-8,12-13H,5-6H2,1-4H3 |
| InChIKey | OLAJGOCDAXKTGQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |