C15H26N2 — CID 107503711
1-(2,6-dimethyl-4-pyridinyl)-N-ethylhexan-1-amine (PubChem CID 107503711) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-pyridinyl)-N-ethylhexan-1-amine.
| Compound Name | 1-(2,6-dimethyl-4-pyridinyl)-N-ethylhexan-1-amine |
|---|---|
| PubChem CID | 107503711 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-(2,6-dimethyl-4-pyridinyl)-N-ethylhexan-1-amine |
| SMILES | CCCCCC(NCC)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C15H26N2/c1-5-7-8-9-15(16-6-2)14-10-12(3)17-13(4)11-14/h10-11,15-16H,5-9H2,1-4H3 |
| InChIKey | LINIFLMVDDVDFF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|