C17H23N3S — CID 107504464
N-[[4-cyclopropyl-2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 107504464) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is N-[[4-cyclopropyl-2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-cyclopropyl-2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107504464 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-[[4-cyclopropyl-2-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(-c2cc(C)nc(C)c2)nc1C1CC1 |
| InChI | InChI=1S/C17H23N3S/c1-4-7-18-10-15-16(13-5-6-13)20-17(21-15)14-8-11(2)19-12(3)9-14/h8-9,13,18H,4-7,10H2,1-3H3 |
| InChIKey | FIJBAVIBSRZQNA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|