C14H17BrN2S2 — CID 114367320
N-[[2-(5-bromothiophen-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114367320) has the molecular formula C14H17BrN2S2 and a molecular weight of 357.34 g/mol. Its IUPAC name is N-[[2-(5-bromothiophen-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(5-bromothiophen-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114367320 |
| Molecular Formula | C14H17BrN2S2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | N-[[2-(5-bromothiophen-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(-c2ccc(Br)s2)nc1C1CC1 |
| InChI | InChI=1S/C14H17BrN2S2/c1-2-7-16-8-11-13(9-3-4-9)17-14(19-11)10-5-6-12(15)18-10/h5-6,9,16H,2-4,7-8H2,1H3 |
| InChIKey | NDUOGPMBHBNFOW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|