C14H25N3O — CID 107504862
[1-(2,6-dimethyl-4-pyridinyl)-4-methoxy-4-methylpentyl]hydrazine (PubChem CID 107504862) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is [1-(2,6-dimethyl-4-pyridinyl)-4-methoxy-4-methylpentyl]hydrazine.
| Compound Name | [1-(2,6-dimethyl-4-pyridinyl)-4-methoxy-4-methylpentyl]hydrazine |
|---|---|
| PubChem CID | 107504862 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | [1-(2,6-dimethyl-4-pyridinyl)-4-methoxy-4-methylpentyl]hydrazine |
| SMILES | COC(C)(C)CCC(NN)c1cc(C)nc(C)c1 |
| InChI | InChI=1S/C14H25N3O/c1-10-8-12(9-11(2)16-10)13(17-15)6-7-14(3,4)18-5/h8-9,13,17H,6-7,15H2,1-5H3 |
| InChIKey | DXOUNINXUMSQPG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|