C14H21Br2NO — CID 114023299
1-(3,5-dibromophenyl)-4-methoxy-N,4-dimethylpentan-1-amine (PubChem CID 114023299) has the molecular formula C14H21Br2NO and a molecular weight of 379.14 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-4-methoxy-N,4-dimethylpentan-1-amine.
| Compound Name | 1-(3,5-dibromophenyl)-4-methoxy-N,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 114023299 |
| Molecular Formula | C14H21Br2NO |
| Molecular Weight | 379.14 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 1-(3,5-dibromophenyl)-4-methoxy-N,4-dimethylpentan-1-amine |
| SMILES | CNC(CCC(C)(C)OC)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H21Br2NO/c1-14(2,18-4)6-5-13(17-3)10-7-11(15)9-12(16)8-10/h7-9,13,17H,5-6H2,1-4H3 |
| InChIKey | IHRNLXVXSROBCC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |