C13H19BrFNO — CID 103031167
1-(3-bromo-5-fluorophenyl)-4-methoxy-4-methylpentan-1-amine (PubChem CID 103031167) has the molecular formula C13H19BrFNO and a molecular weight of 304.20 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-4-methoxy-4-methylpentan-1-amine.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-4-methoxy-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 103031167 |
| Molecular Formula | C13H19BrFNO |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-4-methoxy-4-methylpentan-1-amine |
| SMILES | COC(C)(C)CCC(N)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H19BrFNO/c1-13(2,17-3)5-4-12(16)9-6-10(14)8-11(15)7-9/h6-8,12H,4-5,16H2,1-3H3 |
| InChIKey | FPRGLCCEVSNOIQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |