C12H12O3 — CID 10750706
(1R,8S)-4-methoxytricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6-dione (PubChem CID 10750706) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1R,8S)-4-methoxytricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6-dione.
| Compound Name | (1R,8S)-4-methoxytricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6-dione |
|---|---|
| PubChem CID | 10750706 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1R,8S)-4-methoxytricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6-dione |
| SMILES | COC1=CC(=O)C2=C(C1=O)[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C12H12O3/c1-15-9-5-8(13)10-6-2-3-7(4-6)11(10)12(9)14/h5-7H,2-4H2,1H3/t6-,7+/m0/s1 |
| InChIKey | QCNCGXSZKXFITG-NKWVEPMBSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|