C10H10N2O3 — CID 10750773
(3-methoxy-5-pyridin-2-yl-1,2-oxazol-4-yl)methanol (PubChem CID 10750773) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (3-methoxy-5-pyridin-2-yl-1,2-oxazol-4-yl)methanol.
| Compound Name | (3-methoxy-5-pyridin-2-yl-1,2-oxazol-4-yl)methanol |
|---|---|
| PubChem CID | 10750773 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (3-methoxy-5-pyridin-2-yl-1,2-oxazol-4-yl)methanol |
| SMILES | COc1noc(-c2ccccn2)c1CO |
| InChI | InChI=1S/C10H10N2O3/c1-14-10-7(6-13)9(15-12-10)8-4-2-3-5-11-8/h2-5,13H,6H2,1H3 |
| InChIKey | AQHOEQDZBISHBL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |