C13H15N3 — CID 10751095
2-(2-methylphenyl)-4,5,6,7-tetrahydrobenzotriazole (PubChem CID 10751095) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(2-methylphenyl)-4,5,6,7-tetrahydrobenzotriazole.
| Compound Name | 2-(2-methylphenyl)-4,5,6,7-tetrahydrobenzotriazole |
|---|---|
| PubChem CID | 10751095 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-(2-methylphenyl)-4,5,6,7-tetrahydrobenzotriazole |
| SMILES | Cc1ccccc1-n1nc2c(n1)CCCC2 |
| InChI | InChI=1S/C13H15N3/c1-10-6-2-5-9-13(10)16-14-11-7-3-4-8-12(11)15-16/h2,5-6,9H,3-4,7-8H2,1H3 |
| InChIKey | OZDJYUQKOAAALZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |