C7H15NO2S — CID 107511167
3-(methoxymethyl)-1,4-thiazepane 1-oxide (PubChem CID 107511167) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is 3-(methoxymethyl)-1,4-thiazepane 1-oxide.
| Compound Name | 3-(methoxymethyl)-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 107511167 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 3-(methoxymethyl)-1,4-thiazepane 1-oxide |
| SMILES | COCC1CS(=O)CCCN1 |
| InChI | InChI=1S/C7H15NO2S/c1-10-5-7-6-11(9)4-2-3-8-7/h7-8H,2-6H2,1H3 |
| InChIKey | GGROJOCFTBNRQV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |