C11H22O2Si — CID 10751183
tert-butyl-[[(2S)-5-deuterio-2,3-dihydrofuran-2-yl]methoxy]-dimethylsilane (PubChem CID 10751183) has the molecular formula C11H22O2Si and a molecular weight of 215.39 g/mol. Its IUPAC name is tert-butyl-[[(2S)-5-deuterio-2,3-dihydrofuran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S)-5-deuterio-2,3-dihydrofuran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10751183 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 215.39 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl-[[(2S)-5-deuterio-2,3-dihydrofuran-2-yl]methoxy]-dimethylsilane |
| SMILES | [2H]C1=CC[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C11H22O2Si/c1-11(2,3)14(4,5)13-9-10-7-6-8-12-10/h6,8,10H,7,9H2,1-5H3/t10-/m0/s1/i8D |
| InChIKey | XIYMYIWCRLIFTG-QNICBWFLSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|