C11H20Li2O3Si — CID 135050096
dilithium;2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydro-2H-furan-5-id-3-olate (PubChem CID 135050096) has the molecular formula C11H20Li2O3Si and a molecular weight of 242.25 g/mol. Its IUPAC name is dilithium;2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydro-2H-furan-5-id-3-olate.
| Compound Name | dilithium;2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydro-2H-furan-5-id-3-olate |
|---|---|
| PubChem CID | 135050096 |
| Molecular Formula | C11H20Li2O3Si |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | dilithium;2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dihydro-2H-furan-5-id-3-olate |
| SMILES | CC(C)(C)[Si](C)(C)OCC1O[C-]=CC1[O-].[Li+].[Li+] |
| InChI | InChI=1S/C11H20O3Si.2Li/c1-11(2,3)15(4,5)14-8-10-9(12)6-7-13-10;;/h6,9-10H,8H2,1-5H3;;/q-2;2*+1 |
| InChIKey | OPXSZMQBRCPQRW-UHFFFAOYSA-N |
| XLogP | -4.54 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|