C17H35LiO3Si2 — CID 134974942
lithium tert-butyl-[[(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]-dimethylsilane (PubChem CID 134974942) has the molecular formula C17H35LiO3Si2 and a molecular weight of 350.58 g/mol. Its IUPAC name is lithium tert-butyl-[[(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]-dimethylsilane.
| Compound Name | lithium tert-butyl-[[(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 134974942 |
| Molecular Formula | C17H35LiO3Si2 |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | lithium tert-butyl-[[(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3,4,6-tetrahydropyran-6-id-4-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=[C-]OC[C@H]1O[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C17H35O3Si2.Li/c1-16(2,3)21(7,8)19-14-11-12-18-13-15(14)20-22(9,10)17(4,5)6;/h11,14-15H,13H2,1-10H3;/q-1;+1/t14-,15-;/m1./s1 |
| InChIKey | WCBYRGDIWWUKJG-CTHHTMFSSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|