C14H19NO — CID 10751254
(1S,5R)-6-methoxy-N-methyl-N-phenylbicyclo[3.1.0]hexan-6-amine (PubChem CID 10751254) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (1S,5R)-6-methoxy-N-methyl-N-phenylbicyclo[3.1.0]hexan-6-amine.
| Compound Name | (1S,5R)-6-methoxy-N-methyl-N-phenylbicyclo[3.1.0]hexan-6-amine |
|---|---|
| PubChem CID | 10751254 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1S,5R)-6-methoxy-N-methyl-N-phenylbicyclo[3.1.0]hexan-6-amine |
| SMILES | COC1(N(C)c2ccccc2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C14H19NO/c1-15(11-7-4-3-5-8-11)14(16-2)12-9-6-10-13(12)14/h3-5,7-8,12-13H,6,9-10H2,1-2H3/t12-,13+,14? |
| InChIKey | YMKOLXKYRKAVLR-PBWFPOADSA-N |
| XLogP | 2.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|