C11H7ClF2N2 — CID 107514509
2-chloro-3-(2,3-difluoro-4-methylphenyl)pyrazine (PubChem CID 107514509) has the molecular formula C11H7ClF2N2 and a molecular weight of 240.64 g/mol. Its IUPAC name is 2-chloro-3-(2,3-difluoro-4-methylphenyl)pyrazine.
| Compound Name | 2-chloro-3-(2,3-difluoro-4-methylphenyl)pyrazine |
|---|---|
| PubChem CID | 107514509 |
| Molecular Formula | C11H7ClF2N2 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 2-chloro-3-(2,3-difluoro-4-methylphenyl)pyrazine |
| SMILES | Cc1ccc(-c2nccnc2Cl)c(F)c1F |
| InChI | InChI=1S/C11H7ClF2N2/c1-6-2-3-7(9(14)8(6)13)10-11(12)16-5-4-15-10/h2-5H,1H3 |
| InChIKey | ICIHPYAGDCRHRO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |