C9H9ClN4 — CID 112559067
2-chloro-3-(1,5-dimethylpyrazol-4-yl)pyrazine (PubChem CID 112559067) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 2-chloro-3-(1,5-dimethylpyrazol-4-yl)pyrazine.
| Compound Name | 2-chloro-3-(1,5-dimethylpyrazol-4-yl)pyrazine |
|---|---|
| PubChem CID | 112559067 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-chloro-3-(1,5-dimethylpyrazol-4-yl)pyrazine |
| SMILES | Cc1c(-c2nccnc2Cl)cnn1C |
| InChI | InChI=1S/C9H9ClN4/c1-6-7(5-13-14(6)2)8-9(10)12-4-3-11-8/h3-5H,1-2H3 |
| InChIKey | FCXOWAKKGWQBQS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |