C11H8F2N2S — CID 107516793
6-(2,3-difluoro-4-methylphenyl)-1H-pyrazine-2-thione (PubChem CID 107516793) has the molecular formula C11H8F2N2S and a molecular weight of 238.26 g/mol. Its IUPAC name is 6-(2,3-difluoro-4-methylphenyl)-1H-pyrazine-2-thione.
| Compound Name | 6-(2,3-difluoro-4-methylphenyl)-1H-pyrazine-2-thione |
|---|---|
| PubChem CID | 107516793 |
| Molecular Formula | C11H8F2N2S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-(2,3-difluoro-4-methylphenyl)-1H-pyrazine-2-thione |
| SMILES | Cc1ccc(-c2cncc(=S)[nH]2)c(F)c1F |
| InChI | InChI=1S/C11H8F2N2S/c1-6-2-3-7(11(13)10(6)12)8-4-14-5-9(16)15-8/h2-5H,1H3,(H,15,16) |
| InChIKey | REEMYHIOGNBUNS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|