C12H20BrN3 — CID 107517389
N'-[(3-bromo-2-pyridinyl)methyl]-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 107517389) has the molecular formula C12H20BrN3 and a molecular weight of 286.22 g/mol. Its IUPAC name is N'-[(3-bromo-2-pyridinyl)methyl]-N'-methyl-N-propylethane-1,2-diamine.
| Compound Name | N'-[(3-bromo-2-pyridinyl)methyl]-N'-methyl-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 107517389 |
| Molecular Formula | C12H20BrN3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N'-[(3-bromo-2-pyridinyl)methyl]-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)Cc1ncccc1Br |
| InChI | InChI=1S/C12H20BrN3/c1-3-6-14-8-9-16(2)10-12-11(13)5-4-7-15-12/h4-5,7,14H,3,6,8-10H2,1-2H3 |
| InChIKey | ZXLVUGQMPSBONP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|