About 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide
1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide (PubChem CID 10751809) has the molecular formula C12H17N2O2-
and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide.
Molecular Properties
| Compound Name | 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide |
| PubChem CID | 10751809 |
| Molecular Formula | C12H17N2O2- |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide |
| SMILES | CC(C)N(C(=O)c1cc[c-]c[n+]1[O-])C(C)C |
| InChI | InChI=1S/C12H17N2O2/c1-9(2)14(10(3)4)12(15)11-7-5-6-8-13(11)16/h5,7-10H,1-4H3/q-1 |
| InChIKey | VKFLYNHMNKKNPG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
The IUPAC name of 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide (CID 10751809) is 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide.
What is the SMILES notation for 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
The canonical SMILES for 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide is CC(C)N(C(=O)c1cc[c-]c[n+]1[O-])C(C)C.
What is the InChIKey of 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
The InChIKey is VKFLYNHMNKKNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N2O2/c1-9(2)14(10(3)4)12(15)11-7-5-6-8-13(11)16/h5,7-10H,1-4H3/q-1.
What are the key properties of 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide?
1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide has a molecular weight of 221.28 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-N,N-di(propan-2-yl)-3H-pyridin-1-ium-3-ide-6-carboxamide is sourced from PubChem (CID 10751809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).