C13H16F3N3O — CID 107522455
1-[2-amino-2-[4-(trifluoromethyl)phenyl]ethyl]-3-methylimidazolidin-2-one (PubChem CID 107522455) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-[2-amino-2-[4-(trifluoromethyl)phenyl]ethyl]-3-methylimidazolidin-2-one.
| Compound Name | 1-[2-amino-2-[4-(trifluoromethyl)phenyl]ethyl]-3-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 107522455 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[2-amino-2-[4-(trifluoromethyl)phenyl]ethyl]-3-methylimidazolidin-2-one |
| SMILES | CN1CCN(CC(N)c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C13H16F3N3O/c1-18-6-7-19(12(18)20)8-11(17)9-2-4-10(5-3-9)13(14,15)16/h2-5,11H,6-8,17H2,1H3 |
| InChIKey | NTCWXAZVRUUZDZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |