C11H10N6O2 — CID 107522957
3-(3-hydroxyprop-1-ynyl)-N-(2-methyltetrazol-5-yl)pyridine-2-carboxamide (PubChem CID 107522957) has the molecular formula C11H10N6O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-(2-methyltetrazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-(2-methyltetrazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107522957 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-(2-methyltetrazol-5-yl)pyridine-2-carboxamide |
| SMILES | Cn1nnc(NC(=O)c2ncccc2C#CCO)n1 |
| InChI | InChI=1S/C11H10N6O2/c1-17-15-11(14-16-17)13-10(19)9-8(5-3-7-18)4-2-6-12-9/h2,4,6,18H,7H2,1H3,(H,13,15,19) |
| InChIKey | HUCCMGNKLKFNIW-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|