C11H8N4O2S — CID 107523313
3-(3-hydroxyprop-1-ynyl)-N-(thiadiazol-5-yl)pyridine-2-carboxamide (PubChem CID 107523313) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-(thiadiazol-5-yl)pyridine-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-(thiadiazol-5-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107523313 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-(thiadiazol-5-yl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cnns1)c1ncccc1C#CCO |
| InChI | InChI=1S/C11H8N4O2S/c16-6-2-4-8-3-1-5-12-10(8)11(17)14-9-7-13-15-18-9/h1,3,5,7,16H,6H2,(H,14,17) |
| InChIKey | DPTNNSAQZWZKRL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|