C15H19N3O3 — CID 107523109
N-[3-(ethylamino)-3-oxopropyl]-3-(4-hydroxybut-1-ynyl)pyridine-2-carboxamide (PubChem CID 107523109) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[3-(ethylamino)-3-oxopropyl]-3-(4-hydroxybut-1-ynyl)pyridine-2-carboxamide.
| Compound Name | N-[3-(ethylamino)-3-oxopropyl]-3-(4-hydroxybut-1-ynyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107523109 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[3-(ethylamino)-3-oxopropyl]-3-(4-hydroxybut-1-ynyl)pyridine-2-carboxamide |
| SMILES | CCNC(=O)CCNC(=O)c1ncccc1C#CCCO |
| InChI | InChI=1S/C15H19N3O3/c1-2-16-13(20)8-10-18-15(21)14-12(6-3-4-11-19)7-5-9-17-14/h5,7,9,19H,2,4,8,10-11H2,1H3,(H,16,20)(H,18,21) |
| InChIKey | ADVUSAOLFKNEHU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|