C13H14N2O2S — CID 107523343
3-(3-hydroxyprop-1-ynyl)-N-(thiolan-3-yl)pyridine-2-carboxamide (PubChem CID 107523343) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-(thiolan-3-yl)pyridine-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-(thiolan-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107523343 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-(thiolan-3-yl)pyridine-2-carboxamide |
| SMILES | O=C(NC1CCSC1)c1ncccc1C#CCO |
| InChI | InChI=1S/C13H14N2O2S/c16-7-2-4-10-3-1-6-14-12(10)13(17)15-11-5-8-18-9-11/h1,3,6,11,16H,5,7-9H2,(H,15,17) |
| InChIKey | VTXTUFSJTDOXHG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|