C14H11F4NO — CID 107523625
2-(2,3-difluorophenoxy)-1-(2,4-difluorophenyl)ethanamine (PubChem CID 107523625) has the molecular formula C14H11F4NO and a molecular weight of 285.24 g/mol. Its IUPAC name is 2-(2,3-difluorophenoxy)-1-(2,4-difluorophenyl)ethanamine.
| Compound Name | 2-(2,3-difluorophenoxy)-1-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107523625 |
| Molecular Formula | C14H11F4NO |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(2,3-difluorophenoxy)-1-(2,4-difluorophenyl)ethanamine |
| SMILES | NC(COc1cccc(F)c1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H11F4NO/c15-8-4-5-9(11(17)6-8)12(19)7-20-13-3-1-2-10(16)14(13)18/h1-6,12H,7,19H2 |
| InChIKey | VTTZMRMEQCUHFA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |