C11H13F2NO — CID 63905866
1-cyclopropyl-2-(2,3-difluorophenoxy)ethanamine (PubChem CID 63905866) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,3-difluorophenoxy)ethanamine.
| Compound Name | 1-cyclopropyl-2-(2,3-difluorophenoxy)ethanamine |
|---|---|
| PubChem CID | 63905866 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-cyclopropyl-2-(2,3-difluorophenoxy)ethanamine |
| SMILES | NC(COc1cccc(F)c1F)C1CC1 |
| InChI | InChI=1S/C11H13F2NO/c12-8-2-1-3-10(11(8)13)15-6-9(14)7-4-5-7/h1-3,7,9H,4-6,14H2 |
| InChIKey | BBTJPLLJNUHVKR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |