C15H18N2O4 — CID 107526097
(E)-3-[2-(3-hydroxy-4-methylpiperidine-1-carbonyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 107526097) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is (E)-3-[2-(3-hydroxy-4-methylpiperidine-1-carbonyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-hydroxy-4-methylpiperidine-1-carbonyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107526097 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (E)-3-[2-(3-hydroxy-4-methylpiperidine-1-carbonyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC1CCN(C(=O)c2ncccc2/C=C/C(=O)O)CC1O |
| InChI | InChI=1S/C15H18N2O4/c1-10-6-8-17(9-12(10)18)15(21)14-11(3-2-7-16-14)4-5-13(19)20/h2-5,7,10,12,18H,6,8-9H2,1H3,(H,19,20)/b5-4+ |
| InChIKey | QURNMMWGPHYVRM-SNAWJCMRSA-N |
| XLogP | 1.02 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|