C14H19N3O2 — CID 114087574
(E)-3-[2-(2,4-dimethylpiperazin-1-yl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 114087574) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is (E)-3-[2-(2,4-dimethylpiperazin-1-yl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2,4-dimethylpiperazin-1-yl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114087574 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (E)-3-[2-(2,4-dimethylpiperazin-1-yl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC1CN(C)CCN1c1ncccc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H19N3O2/c1-11-10-16(2)8-9-17(11)14-12(4-3-7-15-14)5-6-13(18)19/h3-7,11H,8-10H2,1-2H3,(H,18,19)/b6-5+ |
| InChIKey | GZCNIIFBBSBPFY-AATRIKPKSA-N |
| XLogP | 1.32 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|