C11H14Br2N2O — CID 107526265
3-bromo-N-(5-bromopentan-2-yl)pyridine-2-carboxamide (PubChem CID 107526265) has the molecular formula C11H14Br2N2O and a molecular weight of 350.05 g/mol. Its IUPAC name is 3-bromo-N-(5-bromopentan-2-yl)pyridine-2-carboxamide.
| Compound Name | 3-bromo-N-(5-bromopentan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107526265 |
| Molecular Formula | C11H14Br2N2O |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 3-bromo-N-(5-bromopentan-2-yl)pyridine-2-carboxamide |
| SMILES | CC(CCCBr)NC(=O)c1ncccc1Br |
| InChI | InChI=1S/C11H14Br2N2O/c1-8(4-2-6-12)15-11(16)10-9(13)5-3-7-14-10/h3,5,7-8H,2,4,6H2,1H3,(H,15,16) |
| InChIKey | KQDPJJIKLBPGRH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|