C14H13ClFN3O2 — CID 107528234
2-chloro-N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]-5-fluoroaniline (PubChem CID 107528234) has the molecular formula C14H13ClFN3O2 and a molecular weight of 309.73 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]-5-fluoroaniline.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 107528234 |
| Molecular Formula | C14H13ClFN3O2 |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-4-nitro-2-pyridinyl)methyl]-5-fluoroaniline |
| SMILES | Cc1cnc(CNc2cc(F)ccc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13ClFN3O2/c1-8-6-17-13(9(2)14(8)19(20)21)7-18-12-5-10(16)3-4-11(12)15/h3-6,18H,7H2,1-2H3 |
| InChIKey | RZFVGYXFRNVJKM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|