C14H20ClFN2 — CID 107528747
1-(2-chloro-5-fluorophenyl)-N,2,3-trimethylpiperidin-4-amine (PubChem CID 107528747) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-N,2,3-trimethylpiperidin-4-amine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-N,2,3-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 107528747 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-N,2,3-trimethylpiperidin-4-amine |
| SMILES | CNC1CCN(c2cc(F)ccc2Cl)C(C)C1C |
| InChI | InChI=1S/C14H20ClFN2/c1-9-10(2)18(7-6-13(9)17-3)14-8-11(16)4-5-12(14)15/h4-5,8-10,13,17H,6-7H2,1-3H3 |
| InChIKey | QYNLBPBMUOFESJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |