C17H22ClN3 — CID 116784923
1-(5-chloroquinolin-8-yl)-N,2,3-trimethylpiperidin-4-amine (PubChem CID 116784923) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 1-(5-chloroquinolin-8-yl)-N,2,3-trimethylpiperidin-4-amine.
| Compound Name | 1-(5-chloroquinolin-8-yl)-N,2,3-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 116784923 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-(5-chloroquinolin-8-yl)-N,2,3-trimethylpiperidin-4-amine |
| SMILES | CNC1CCN(c2ccc(Cl)c3cccnc23)C(C)C1C |
| InChI | InChI=1S/C17H22ClN3/c1-11-12(2)21(10-8-15(11)19-3)16-7-6-14(18)13-5-4-9-20-17(13)16/h4-7,9,11-12,15,19H,8,10H2,1-3H3 |
| InChIKey | DHBITEJWBGUMJT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |