C14H14ClN3O — CID 116785599
3-amino-1-(5-chloroquinolin-8-yl)piperidin-2-one (PubChem CID 116785599) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 3-amino-1-(5-chloroquinolin-8-yl)piperidin-2-one.
| Compound Name | 3-amino-1-(5-chloroquinolin-8-yl)piperidin-2-one |
|---|---|
| PubChem CID | 116785599 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-amino-1-(5-chloroquinolin-8-yl)piperidin-2-one |
| SMILES | NC1CCCN(c2ccc(Cl)c3cccnc23)C1=O |
| InChI | InChI=1S/C14H14ClN3O/c15-10-5-6-12(13-9(10)3-1-7-17-13)18-8-2-4-11(16)14(18)19/h1,3,5-7,11H,2,4,8,16H2 |
| InChIKey | PZVNAGJQWGNXSU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |