C14H15NOS — CID 10752896
(6S,7S)-7-ethenyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 10752896) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is (6S,7S)-7-ethenyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (6S,7S)-7-ethenyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 10752896 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (6S,7S)-7-ethenyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C=C[C@H]1C(=O)N2CCCS[C@]12c1ccccc1 |
| InChI | InChI=1S/C14H15NOS/c1-2-12-13(16)15-9-6-10-17-14(12,15)11-7-4-3-5-8-11/h2-5,7-8,12H,1,6,9-10H2/t12-,14+/m0/s1 |
| InChIKey | OLUSIXXDGAXSEK-GXTWGEPZSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|