C19H26N2OS2 — CID 135015328
[(1R,6S)-7-benzyl-8-oxo-7-azabicyclo[4.2.0]octan-2-yl] N,N-diethylcarbamodithioate (PubChem CID 135015328) has the molecular formula C19H26N2OS2 and a molecular weight of 362.56 g/mol. Its IUPAC name is [(1R,6S)-7-benzyl-8-oxo-7-azabicyclo[4.2.0]octan-2-yl] N,N-diethylcarbamodithioate.
| Compound Name | [(1R,6S)-7-benzyl-8-oxo-7-azabicyclo[4.2.0]octan-2-yl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 135015328 |
| Molecular Formula | C19H26N2OS2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [(1R,6S)-7-benzyl-8-oxo-7-azabicyclo[4.2.0]octan-2-yl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC1CCC[C@H]2[C@@H]1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2OS2/c1-3-20(4-2)19(23)24-16-12-8-11-15-17(16)18(22)21(15)13-14-9-6-5-7-10-14/h5-7,9-10,15-17H,3-4,8,11-13H2,1-2H3/t15-,16?,17-/m0/s1 |
| InChIKey | YUARTSDCZPNVLN-QRFGZVGRSA-N |
| XLogP | 3.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|