C16H19NOS — CID 10564203
(6S,7S)-7-ethenyl-3,3-dimethyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 10564203) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is (6S,7S)-7-ethenyl-3,3-dimethyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (6S,7S)-7-ethenyl-3,3-dimethyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 10564203 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (6S,7S)-7-ethenyl-3,3-dimethyl-6-phenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C=C[C@H]1C(=O)N2CC(C)(C)CS[C@]12c1ccccc1 |
| InChI | InChI=1S/C16H19NOS/c1-4-13-14(18)17-10-15(2,3)11-19-16(13,17)12-8-6-5-7-9-12/h4-9,13H,1,10-11H2,2-3H3/t13-,16+/m0/s1 |
| InChIKey | BLXGMZHVKJOHOR-XJKSGUPXSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|