C19H21NOS — CID 101397901
(3R,4S)-1-tert-butyl-4-phenyl-3-phenylsulfanylazetidin-2-one (PubChem CID 101397901) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-4-phenyl-3-phenylsulfanylazetidin-2-one.
| Compound Name | (3R,4S)-1-tert-butyl-4-phenyl-3-phenylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 101397901 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3R,4S)-1-tert-butyl-4-phenyl-3-phenylsulfanylazetidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@H](Sc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H21NOS/c1-19(2,3)20-16(14-10-6-4-7-11-14)17(18(20)21)22-15-12-8-5-9-13-15/h4-13,16-17H,1-3H3/t16-,17+/m0/s1 |
| InChIKey | WETYWJJNLNZORT-DLBZAZTESA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |