C15H17NOS — CID 10801276
(6S,7S)-6-phenyl-7-[(E)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 10801276) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is (6S,7S)-6-phenyl-7-[(E)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (6S,7S)-6-phenyl-7-[(E)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 10801276 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (6S,7S)-6-phenyl-7-[(E)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C/C=C/[C@H]1C(=O)N2CCCS[C@]12c1ccccc1 |
| InChI | InChI=1S/C15H17NOS/c1-2-7-13-14(17)16-10-6-11-18-15(13,16)12-8-4-3-5-9-12/h2-5,7-9,13H,6,10-11H2,1H3/b7-2+/t13-,15+/m0/s1 |
| InChIKey | AYXMKNRXDLIYAO-LUIDYQKVSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|