C17H21NOS — CID 10708450
(6S,7S)-3,3-dimethyl-6-phenyl-7-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 10708450) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is (6S,7S)-3,3-dimethyl-6-phenyl-7-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (6S,7S)-3,3-dimethyl-6-phenyl-7-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 10708450 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (6S,7S)-3,3-dimethyl-6-phenyl-7-prop-1-en-2-yl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | C=C(C)[C@H]1C(=O)N2CC(C)(C)CS[C@]12c1ccccc1 |
| InChI | InChI=1S/C17H21NOS/c1-12(2)14-15(19)18-10-16(3,4)11-20-17(14,18)13-8-6-5-7-9-13/h5-9,14H,1,10-11H2,2-4H3/t14-,17+/m0/s1 |
| InChIKey | HECHSMCZUJTREY-WMLDXEAASA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|