C16H25NO — CID 10753036
(6E)-6-heptylidene-8-methyl-1,2,5,8a-tetrahydroindolizin-3-one (PubChem CID 10753036) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (6E)-6-heptylidene-8-methyl-1,2,5,8a-tetrahydroindolizin-3-one.
| Compound Name | (6E)-6-heptylidene-8-methyl-1,2,5,8a-tetrahydroindolizin-3-one |
|---|---|
| PubChem CID | 10753036 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (6E)-6-heptylidene-8-methyl-1,2,5,8a-tetrahydroindolizin-3-one |
| SMILES | CCCCCC/C=C1\C=C(C)C2CCC(=O)N2C1 |
| InChI | InChI=1S/C16H25NO/c1-3-4-5-6-7-8-14-11-13(2)15-9-10-16(18)17(15)12-14/h8,11,15H,3-7,9-10,12H2,1-2H3/b14-8+ |
| InChIKey | NQUBGQSBMMVXDM-RIYZIHGNSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|