C15H20ClFN2 — CID 107531408
8-(2-chloro-5-fluorophenyl)-N-ethyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 107531408) has the molecular formula C15H20ClFN2 and a molecular weight of 282.79 g/mol. Its IUPAC name is 8-(2-chloro-5-fluorophenyl)-N-ethyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-(2-chloro-5-fluorophenyl)-N-ethyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 107531408 |
| Molecular Formula | C15H20ClFN2 |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 8-(2-chloro-5-fluorophenyl)-N-ethyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CCNC1CC2CCC(C1)N2c1cc(F)ccc1Cl |
| InChI | InChI=1S/C15H20ClFN2/c1-2-18-11-8-12-4-5-13(9-11)19(12)15-7-10(17)3-6-14(15)16/h3,6-7,11-13,18H,2,4-5,8-9H2,1H3 |
| InChIKey | CULYUMDUPVGSEA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |