C17H30O — CID 10753211
(1S,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentan-1-ol (PubChem CID 10753211) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (1S,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentan-1-ol.
| Compound Name | (1S,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10753211 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (1S,2S,3R)-2-(2,2-dimethylpent-4-enyl)-3-methyl-1-(2-methylprop-2-enyl)cyclopentan-1-ol |
| SMILES | C=CCC(C)(C)C[C@H]1[C@H](C)CC[C@]1(O)CC(=C)C |
| InChI | InChI=1S/C17H30O/c1-7-9-16(5,6)12-15-14(4)8-10-17(15,18)11-13(2)3/h7,14-15,18H,1-2,8-12H2,3-6H3/t14-,15+,17+/m1/s1 |
| InChIKey | GIIAPBWSGDMVLN-VYDXJSESSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|