C15H23BrFN3 — CID 107532343
[2-bromo-4-(4-butan-2-ylpiperazin-1-yl)-3-fluorophenyl]methanamine (PubChem CID 107532343) has the molecular formula C15H23BrFN3 and a molecular weight of 344.27 g/mol. Its IUPAC name is [2-bromo-4-(4-butan-2-ylpiperazin-1-yl)-3-fluorophenyl]methanamine.
| Compound Name | [2-bromo-4-(4-butan-2-ylpiperazin-1-yl)-3-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 107532343 |
| Molecular Formula | C15H23BrFN3 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [2-bromo-4-(4-butan-2-ylpiperazin-1-yl)-3-fluorophenyl]methanamine |
| SMILES | CCC(C)N1CCN(c2ccc(CN)c(Br)c2F)CC1 |
| InChI | InChI=1S/C15H23BrFN3/c1-3-11(2)19-6-8-20(9-7-19)13-5-4-12(10-18)14(16)15(13)17/h4-5,11H,3,6-10,18H2,1-2H3 |
| InChIKey | SDNRCTAWNXBLBX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |