C16H22BrFN2 — CID 107532386
4-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-2-fluoro-N-methylaniline (PubChem CID 107532386) has the molecular formula C16H22BrFN2 and a molecular weight of 341.27 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-2-fluoro-N-methylaniline.
| Compound Name | 4-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-2-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 107532386 |
| Molecular Formula | C16H22BrFN2 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-2-fluoro-N-methylaniline |
| SMILES | CN(CC1CC2CCC1C2)c1ccc(CN)c(Br)c1F |
| InChI | InChI=1S/C16H22BrFN2/c1-20(9-13-7-10-2-3-11(13)6-10)14-5-4-12(8-19)15(17)16(14)18/h4-5,10-11,13H,2-3,6-9,19H2,1H3 |
| InChIKey | MBCUIMMLZBEZNS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |